C20H11Cl3N2O2 — CID 4623545
2-chloro-N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 4623545) has the molecular formula C20H11Cl3N2O2 and a molecular weight of 417.68 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 2-chloro-N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 4623545 |
| Molecular Formula | C20H11Cl3N2O2 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | 2-chloro-N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | O=C(Nc1ccc2oc(-c3cc(Cl)ccc3Cl)nc2c1)c1ccccc1Cl |
| InChI | InChI=1S/C20H11Cl3N2O2/c21-11-5-7-16(23)14(9-11)20-25-17-10-12(6-8-18(17)27-20)24-19(26)13-3-1-2-4-15(13)22/h1-10H,(H,24,26) |
| InChIKey | BZONBLXNSMRICG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |