C20H12Cl2N2O2 — CID 1126393
2-chloro-N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 1126393) has the molecular formula C20H12Cl2N2O2 and a molecular weight of 383.23 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 2-chloro-N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 1126393 |
| Molecular Formula | C20H12Cl2N2O2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-chloro-N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | O=C(Nc1ccc2oc(-c3ccccc3Cl)nc2c1)c1ccccc1Cl |
| InChI | InChI=1S/C20H12Cl2N2O2/c21-15-7-3-1-5-13(15)19(25)23-12-9-10-18-17(11-12)24-20(26-18)14-6-2-4-8-16(14)22/h1-11H,(H,23,25) |
| InChIKey | SNKHNUJHAOPTTQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |