C21H14Cl2N2O3 — CID 1049602
N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-2-methoxybenzamide (PubChem CID 1049602) has the molecular formula C21H14Cl2N2O3 and a molecular weight of 413.26 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-2-methoxybenzamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 1049602 |
| Molecular Formula | C21H14Cl2N2O3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc2oc(-c3ccc(Cl)cc3Cl)nc2c1 |
| InChI | InChI=1S/C21H14Cl2N2O3/c1-27-18-5-3-2-4-15(18)20(26)24-13-7-9-19-17(11-13)25-21(28-19)14-8-6-12(22)10-16(14)23/h2-11H,1H3,(H,24,26) |
| InChIKey | SYDLYYCWQWCKKB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |