C20H14ClN3O3 — CID 1367090
5-chloro-2-methoxy-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)benzamide (PubChem CID 1367090) has the molecular formula C20H14ClN3O3 and a molecular weight of 379.80 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 5-chloro-2-methoxy-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 1367090 |
| Molecular Formula | C20H14ClN3O3 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 5-chloro-2-methoxy-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1ccc2oc(-c3ccncc3)nc2c1 |
| InChI | InChI=1S/C20H14ClN3O3/c1-26-17-4-2-13(21)10-15(17)19(25)23-14-3-5-18-16(11-14)24-20(27-18)12-6-8-22-9-7-12/h2-11H,1H3,(H,23,25) |
| InChIKey | RIOWLILDMCNTSR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |