C21H15ClN2O3 — CID 1049579
N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-methoxybenzamide (PubChem CID 1049579) has the molecular formula C21H15ClN2O3 and a molecular weight of 378.82 g/mol. Its IUPAC name is N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-methoxybenzamide.
| Compound Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 1049579 |
| Molecular Formula | C21H15ClN2O3 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(-c2nc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C21H15ClN2O3/c1-26-18-5-3-2-4-16(18)20(25)23-15-9-6-13(7-10-15)21-24-17-12-14(22)8-11-19(17)27-21/h2-12H,1H3,(H,23,25) |
| InChIKey | NXOZATRTYYPXPY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |