C21H11ClF4N2O3 — CID 17110595
N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17110595) has the molecular formula C21H11ClF4N2O3 and a molecular weight of 450.78 g/mol. Its IUPAC name is N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17110595 |
| Molecular Formula | C21H11ClF4N2O3 |
| Molecular Weight | 450.78 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)Nc2ccc(-c3nc4cc(Cl)ccc4o3)cc2)c(F)c1F |
| InChI | InChI=1S/C21H11ClF4N2O3/c1-30-19-17(25)15(23)14(16(24)18(19)26)20(29)27-11-5-2-9(3-6-11)21-28-12-8-10(22)4-7-13(12)31-21/h2-8H,1H3,(H,27,29) |
| InChIKey | ZLACVOATCOTJJG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.78 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|