C21H11F5N2O3 — CID 4135318
2,3,4,5,6-pentafluoro-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 4135318) has the molecular formula C21H11F5N2O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 4135318 |
| Molecular Formula | C21H11F5N2O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=O)c4c(F)c(F)c(F)c(F)c4F)ccc3o2)cc1 |
| InChI | InChI=1S/C21H11F5N2O3/c1-30-11-5-2-9(3-6-11)21-28-12-8-10(4-7-13(12)31-21)27-20(29)14-15(22)17(24)19(26)18(25)16(14)23/h2-8H,1H3,(H,27,29) |
| InChIKey | KNPZVFOQDPTLPE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|