C20H15N3O3 — CID 25187792
N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]pyridine-4-carboxamide (PubChem CID 25187792) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]pyridine-4-carboxamide.
| Compound Name | N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 25187792 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]pyridine-4-carboxamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=O)c4ccncc4)ccc3o2)cc1 |
| InChI | InChI=1S/C20H15N3O3/c1-25-16-5-2-14(3-6-16)20-23-17-12-15(4-7-18(17)26-20)22-19(24)13-8-10-21-11-9-13/h2-12H,1H3,(H,22,24) |
| InChIKey | UUMDNQXATUIWID-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |