C27H19N3O3 — CID 53356244
N-[4-(5-benzamido-1,3-benzoxazol-2-yl)phenyl]benzamide (PubChem CID 53356244) has the molecular formula C27H19N3O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[4-(5-benzamido-1,3-benzoxazol-2-yl)phenyl]benzamide.
| Compound Name | N-[4-(5-benzamido-1,3-benzoxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 53356244 |
| Molecular Formula | C27H19N3O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[4-(5-benzamido-1,3-benzoxazol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nc3cc(NC(=O)c4ccccc4)ccc3o2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H19N3O3/c31-25(18-7-3-1-4-8-18)28-21-13-11-20(12-14-21)27-30-23-17-22(15-16-24(23)33-27)29-26(32)19-9-5-2-6-10-19/h1-17H,(H,28,31)(H,29,32) |
| InChIKey | IZWXFCDVQSEQQS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |