C25H17N3O2 — CID 2217662
N-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]pyridine-3-carboxamide (PubChem CID 2217662) has the molecular formula C25H17N3O2 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]pyridine-3-carboxamide.
| Compound Name | N-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2217662 |
| Molecular Formula | C25H17N3O2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2oc(-c3ccc(-c4ccccc4)cc3)nc2c1)c1cccnc1 |
| InChI | InChI=1S/C25H17N3O2/c29-24(20-7-4-14-26-16-20)27-21-12-13-23-22(15-21)28-25(30-23)19-10-8-18(9-11-19)17-5-2-1-3-6-17/h1-16H,(H,27,29) |
| InChIKey | NRCPJZHSJBDYKY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |