C25H16ClN3O2 — CID 4663208
2-chloro-N-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]pyridine-3-carboxamide (PubChem CID 4663208) has the molecular formula C25H16ClN3O2 and a molecular weight of 425.88 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4663208 |
| Molecular Formula | C25H16ClN3O2 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-chloro-N-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2oc(-c3ccc(-c4ccccc4)cc3)nc2c1)c1cccnc1Cl |
| InChI | InChI=1S/C25H16ClN3O2/c26-23-20(7-4-14-27-23)24(30)28-19-12-13-22-21(15-19)29-25(31-22)18-10-8-17(9-11-18)16-5-2-1-3-6-16/h1-15H,(H,28,30) |
| InChIKey | XDLCJWNQXYEZJS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|