C20H13FN2O2 — CID 718625
2-fluoro-N-(2-phenyl-1,3-benzoxazol-5-yl)benzamide (PubChem CID 718625) has the molecular formula C20H13FN2O2 and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-fluoro-N-(2-phenyl-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 2-fluoro-N-(2-phenyl-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 718625 |
| Molecular Formula | C20H13FN2O2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-fluoro-N-(2-phenyl-1,3-benzoxazol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2oc(-c3ccccc3)nc2c1)c1ccccc1F |
| InChI | InChI=1S/C20H13FN2O2/c21-16-9-5-4-8-15(16)19(24)22-14-10-11-18-17(12-14)23-20(25-18)13-6-2-1-3-7-13/h1-12H,(H,22,24) |
| InChIKey | BREJECQOAIYGKD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |