(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid

C13H9N3O3 — CID 175414286

IUPAC(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid
SMILESO=C(O)Nc1ccc2oc(-c3cccnc3)nc2c1
InChIInChI=1S/C13H9N3O3/c17-13(18)15-9-3-4-11-10(6-9)16-12(19-11)8-2-1-5-14-7-8/h1-7,15H,(H,17,18)
InChIKeyQKJRWIBNQHCPQP-UHFFFAOYSA-N
MW255.23 g/mol
LogP2.98
Rot. Bonds2

About (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid

(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid (PubChem CID 175414286) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid.

Molecular Properties

Compound Name(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid
PubChem CID175414286
Molecular FormulaC13H9N3O3
Molecular Weight255.23 g/mol
Exact Mass255.06
IUPAC Name(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid
SMILESO=C(O)Nc1ccc2oc(-c3cccnc3)nc2c1
InChIInChI=1S/C13H9N3O3/c17-13(18)15-9-3-4-11-10(6-9)16-12(19-11)8-2-1-5-14-7-8/h1-7,15H,(H,17,18)
InChIKeyQKJRWIBNQHCPQP-UHFFFAOYSA-N
XLogP2.98
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.23
LogP ≤ 52.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid?
The IUPAC name of (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid (CID 175414286) is (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid.
What is the SMILES notation for (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid?
The canonical SMILES for (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid is O=C(O)Nc1ccc2oc(-c3cccnc3)nc2c1.
What is the InChIKey of (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid?
The InChIKey is QKJRWIBNQHCPQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O3/c17-13(18)15-9-3-4-11-10(6-9)16-12(19-11)8-2-1-5-14-7-8/h1-7,15H,(H,17,18).
What are the key properties of (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid?
(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid has a molecular weight of 255.23 g/mol, XLogP of 2.98, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamic acid is sourced from PubChem (CID 175414286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).