C20H13ClN4O2S — CID 2269824
4-chloro-N-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamothioyl]benzamide (PubChem CID 2269824) has the molecular formula C20H13ClN4O2S and a molecular weight of 408.87 g/mol. Its IUPAC name is 4-chloro-N-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 4-chloro-N-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2269824 |
| Molecular Formula | C20H13ClN4O2S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 4-chloro-N-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3cccnc3)nc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H13ClN4O2S/c21-14-5-3-12(4-6-14)18(26)25-20(28)23-15-7-8-17-16(10-15)24-19(27-17)13-2-1-9-22-11-13/h1-11H,(H2,23,25,26,28) |
| InChIKey | SOQZFIABYWAPFQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|