C27H16ClF2N3O2S — CID 21232939
N-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylbenzamide (PubChem CID 21232939) has the molecular formula C27H16ClF2N3O2S and a molecular weight of 519.96 g/mol. Its IUPAC name is N-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylbenzamide.
| Compound Name | N-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 21232939 |
| Molecular Formula | C27H16ClF2N3O2S |
| Molecular Weight | 519.96 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | N-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylbenzamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3cc(F)c(F)cc3Cl)nc2c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H16ClF2N3O2S/c28-20-14-22(30)21(29)13-19(20)26-32-23-12-18(10-11-24(23)35-26)31-27(36)33-25(34)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-14H,(H2,31,33,34,36) |
| InChIKey | MRJHYYTWKIKCRG-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.96 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|