C31H20ClN3O2S — CID 21213413
N-[[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylbenzamide (PubChem CID 21213413) has the molecular formula C31H20ClN3O2S and a molecular weight of 534.04 g/mol. Its IUPAC name is N-[[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylbenzamide.
| Compound Name | N-[[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 21213413 |
| Molecular Formula | C31H20ClN3O2S |
| Molecular Weight | 534.04 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | N-[[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylbenzamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3cccc4c(Cl)cccc34)nc2c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H20ClN3O2S/c32-26-11-5-8-23-24(26)9-4-10-25(23)30-34-27-18-22(16-17-28(27)37-30)33-31(38)35-29(36)21-14-12-20(13-15-21)19-6-2-1-3-7-19/h1-18H,(H2,33,35,36,38) |
| InChIKey | OSYGFIPMJNXXOO-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.04 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|