C26H14ClF4N3O3S — CID 17316619
N-[[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17316619) has the molecular formula C26H14ClF4N3O3S and a molecular weight of 559.93 g/mol. Its IUPAC name is N-[[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17316619 |
| Molecular Formula | C26H14ClF4N3O3S |
| Molecular Weight | 559.93 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | N-[[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccc3oc(-c4cccc5c(Cl)cccc45)nc3c2)c(F)c1F |
| InChI | InChI=1S/C26H14ClF4N3O3S/c1-36-23-21(30)19(28)18(20(29)22(23)31)24(35)34-26(38)32-11-8-9-17-16(10-11)33-25(37-17)14-6-2-5-13-12(14)4-3-7-15(13)27/h2-10H,1H3,(H2,32,34,35,38) |
| InChIKey | IJFUPGXICIAJCW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.93 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|