C26H15F4N3O3S — CID 17316597
2,3,5,6-tetrafluoro-4-methoxy-N-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)carbamothioyl]benzamide (PubChem CID 17316597) has the molecular formula C26H15F4N3O3S and a molecular weight of 525.48 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17316597 |
| Molecular Formula | C26H15F4N3O3S |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)carbamothioyl]benzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccc3oc(-c4cccc5ccccc45)nc3c2)c(F)c1F |
| InChI | InChI=1S/C26H15F4N3O3S/c1-35-23-21(29)19(27)18(20(28)22(23)30)24(34)33-26(37)31-13-9-10-17-16(11-13)32-25(36-17)15-8-4-6-12-5-2-3-7-14(12)15/h2-11H,1H3,(H2,31,33,34,37) |
| InChIKey | UUPKMMBMHYNDNU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|