C25H19F4N3O4S — CID 137066818
N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 137066818) has the molecular formula C25H19F4N3O4S and a molecular weight of 533.50 g/mol. Its IUPAC name is N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 137066818 |
| Molecular Formula | C25H19F4N3O4S |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | CCc1ccc2oc(-c3cc(NC(=S)NC(=O)c4c(F)c(F)c(OC)c(F)c4F)cc(C)c3O)nc2c1 |
| InChI | InChI=1S/C25H19F4N3O4S/c1-4-11-5-6-15-14(8-11)31-24(36-15)13-9-12(7-10(2)21(13)33)30-25(37)32-23(34)16-17(26)19(28)22(35-3)20(29)18(16)27/h5-9,33H,4H2,1-3H3,(H2,30,32,34,37) |
| InChIKey | KPMVPEYJPPVTIN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|