C23H17ClFN3O2S — CID 2279693
N-[[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-fluorobenzamide (PubChem CID 2279693) has the molecular formula C23H17ClFN3O2S and a molecular weight of 453.93 g/mol. Its IUPAC name is N-[[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 2279693 |
| Molecular Formula | C23H17ClFN3O2S |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-fluorobenzamide |
| SMILES | CCc1ccc2oc(-c3cc(NC(=S)NC(=O)c4ccccc4F)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C23H17ClFN3O2S/c1-2-13-7-10-20-19(11-13)27-22(30-20)16-12-14(8-9-17(16)24)26-23(31)28-21(29)15-5-3-4-6-18(15)25/h3-12H,2H2,1H3,(H2,26,28,29,31) |
| InChIKey | YZFFGZDOXSMNLI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|