C24H20ClN3O4S — CID 135775887
5-chloro-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 135775887) has the molecular formula C24H20ClN3O4S and a molecular weight of 481.96 g/mol. Its IUPAC name is 5-chloro-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 135775887 |
| Molecular Formula | C24H20ClN3O4S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 5-chloro-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCc1ccc2oc(-c3cc(NC(=S)NC(=O)c4cc(Cl)ccc4OC)ccc3O)nc2c1 |
| InChI | InChI=1S/C24H20ClN3O4S/c1-3-13-4-8-21-18(10-13)27-23(32-21)16-12-15(6-7-19(16)29)26-24(33)28-22(30)17-11-14(25)5-9-20(17)31-2/h4-12,29H,3H2,1-2H3,(H2,26,28,30,33) |
| InChIKey | XWVDLXZQMMIXGY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|