C23H18IN3O3S — CID 137066979
N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-iodobenzamide (PubChem CID 137066979) has the molecular formula C23H18IN3O3S and a molecular weight of 543.39 g/mol. Its IUPAC name is N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-iodobenzamide.
| Compound Name | N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 137066979 |
| Molecular Formula | C23H18IN3O3S |
| Molecular Weight | 543.39 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-iodobenzamide |
| SMILES | CCc1ccc2oc(-c3cc(NC(=S)NC(=O)c4ccc(I)cc4)ccc3O)nc2c1 |
| InChI | InChI=1S/C23H18IN3O3S/c1-2-13-3-10-20-18(11-13)26-22(30-20)17-12-16(8-9-19(17)28)25-23(31)27-21(29)14-4-6-15(24)7-5-14/h3-12,28H,2H2,1H3,(H2,25,27,29,31) |
| InChIKey | YWVWXGLBOCMBID-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|