C26H24ClN3O2S — CID 17114066
N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-ethylbenzamide (PubChem CID 17114066) has the molecular formula C26H24ClN3O2S and a molecular weight of 478.02 g/mol. Its IUPAC name is N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-ethylbenzamide.
| Compound Name | N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 17114066 |
| Molecular Formula | C26H24ClN3O2S |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NC(=S)Nc2ccc(Cl)c(-c3nc4cc(C(C)C)ccc4o3)c2)cc1 |
| InChI | InChI=1S/C26H24ClN3O2S/c1-4-16-5-7-17(8-6-16)24(31)30-26(33)28-19-10-11-21(27)20(14-19)25-29-22-13-18(15(2)3)9-12-23(22)32-25/h5-15H,4H2,1-3H3,(H2,28,30,31,33) |
| InChIKey | SVCSMTXOWSAEOA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|