C30H23Cl2N3O3S — CID 4694937
3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 4694937) has the molecular formula C30H23Cl2N3O3S and a molecular weight of 576.51 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4694937 |
| Molecular Formula | C30H23Cl2N3O3S |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CC(C)c1ccc2oc(-c3cc(NC(=S)NC(=O)C=Cc4ccc(-c5ccc(Cl)cc5)o4)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C30H23Cl2N3O3S/c1-17(2)19-5-12-27-25(15-19)34-29(38-27)23-16-21(8-11-24(23)32)33-30(39)35-28(36)14-10-22-9-13-26(37-22)18-3-6-20(31)7-4-18/h3-17H,1-2H3,(H2,33,35,36,39) |
| InChIKey | AJKGFBYYKDXYIK-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|