C28H18Cl3N3O4S — CID 17315767
(E)-N-[[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17315767) has the molecular formula C28H18Cl3N3O4S and a molecular weight of 598.90 g/mol. Its IUPAC name is (E)-N-[[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17315767 |
| Molecular Formula | C28H18Cl3N3O4S |
| Molecular Weight | 598.90 g/mol |
| Exact Mass | 597.01 |
| IUPAC Name | (E)-N-[[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=S)NC(=O)/C=C/c4ccc(-c5cc(Cl)cc(Cl)c5)o4)ccc3o2)cc1Cl |
| InChI | InChI=1S/C28H18Cl3N3O4S/c1-36-24-6-2-15(12-21(24)31)27-33-22-14-19(3-7-25(22)38-27)32-28(39)34-26(35)9-5-20-4-8-23(37-20)16-10-17(29)13-18(30)11-16/h2-14H,1H3,(H2,32,34,35,39)/b9-5+ |
| InChIKey | RXBGYGARRLJITC-WEVVVXLNSA-N |
| XLogP | 8.25 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.90 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|