C33H21Cl2N3O3S — CID 17316670
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]prop-2-enamide (PubChem CID 17316670) has the molecular formula C33H21Cl2N3O3S and a molecular weight of 610.52 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17316670 |
| Molecular Formula | C33H21Cl2N3O3S |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 609.07 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1ccc2oc(-c3ccc(-c4ccccc4)cc3)nc2c1 |
| InChI | InChI=1S/C33H21Cl2N3O3S/c34-24-16-23(17-25(35)18-24)29-14-11-27(40-29)12-15-31(39)38-33(42)36-26-10-13-30-28(19-26)37-32(41-30)22-8-6-21(7-9-22)20-4-2-1-3-5-20/h1-19H,(H2,36,38,39,42)/b15-12+ |
| InChIKey | OYXKRTDURGVXQL-NTCAYCPXSA-N |
| XLogP | 9.26 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|