C27H19N3O3S — CID 17336319
(E)-N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide (PubChem CID 17336319) has the molecular formula C27H19N3O3S and a molecular weight of 465.53 g/mol. Its IUPAC name is (E)-N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17336319 |
| Molecular Formula | C27H19N3O3S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (E)-N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)o1)NC(=S)Nc1cccc(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C27H19N3O3S/c31-25(16-14-21-13-15-23(32-21)18-7-2-1-3-8-18)30-27(34)28-20-10-6-9-19(17-20)26-29-22-11-4-5-12-24(22)33-26/h1-17H,(H2,28,30,31,34)/b16-14+ |
| InChIKey | ZMDPYIQMRBHTJE-JQIJEIRASA-N |
| XLogP | 6.28 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|