C28H23N3O3S — CID 17274764
2-methyl-N-[3-[[(E)-3-(5-phenylfuran-2-yl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide (PubChem CID 17274764) has the molecular formula C28H23N3O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 2-methyl-N-[3-[[(E)-3-(5-phenylfuran-2-yl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | 2-methyl-N-[3-[[(E)-3-(5-phenylfuran-2-yl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 17274764 |
| Molecular Formula | C28H23N3O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-methyl-N-[3-[[(E)-3-(5-phenylfuran-2-yl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(NC(=S)NC(=O)/C=C/c2ccc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C28H23N3O3S/c1-19-8-5-6-13-24(19)27(33)29-21-11-7-12-22(18-21)30-28(35)31-26(32)17-15-23-14-16-25(34-23)20-9-3-2-4-10-20/h2-18H,1H3,(H,29,33)(H2,30,31,32,35)/b17-15+ |
| InChIKey | XJEPXEUPIDCKMS-BMRADRMJSA-N |
| XLogP | 6.03 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|