C28H22ClN3O3S — CID 23101536
N-[3-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]benzamide (PubChem CID 23101536) has the molecular formula C28H22ClN3O3S and a molecular weight of 516.02 g/mol. Its IUPAC name is N-[3-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | N-[3-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 23101536 |
| Molecular Formula | C28H22ClN3O3S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | N-[3-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3cccc(NC(=O)c4ccccc4)c3)o2)cc1Cl |
| InChI | InChI=1S/C28H22ClN3O3S/c1-18-10-11-20(16-24(18)29)25-14-12-23(35-25)13-15-26(33)32-28(36)31-22-9-5-8-21(17-22)30-27(34)19-6-3-2-4-7-19/h2-17H,1H3,(H,30,34)(H2,31,32,33,36)/b15-13+ |
| InChIKey | COQCOIMNKLAEMY-FYWRMAATSA-N |
| XLogP | 6.69 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|