C22H17ClN4O3S — CID 71951970
3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]prop-2-enamide (PubChem CID 71951970) has the molecular formula C22H17ClN4O3S and a molecular weight of 452.92 g/mol. Its IUPAC name is 3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 71951970 |
| Molecular Formula | C22H17ClN4O3S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(C=CC(=O)NC(=S)Nc3ccc4[nH]c(=O)[nH]c4c3)o2)cc1Cl |
| InChI | InChI=1S/C22H17ClN4O3S/c1-12-2-3-13(10-16(12)23)19-8-5-15(30-19)6-9-20(28)27-22(31)24-14-4-7-17-18(11-14)26-21(29)25-17/h2-11H,1H3,(H2,25,26,29)(H2,24,27,28,31) |
| InChIKey | UVGYFYZQJLGJLN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|