C22H18Cl2N2O2S — CID 22781802
(E)-N-[(3-chloro-4-methylphenyl)carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 22781802) has the molecular formula C22H18Cl2N2O2S and a molecular weight of 445.37 g/mol. Its IUPAC name is (E)-N-[(3-chloro-4-methylphenyl)carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(3-chloro-4-methylphenyl)carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 22781802 |
| Molecular Formula | C22H18Cl2N2O2S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | (E)-N-[(3-chloro-4-methylphenyl)carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)/C=C/c2ccc(-c3ccc(C)c(Cl)c3)o2)cc1Cl |
| InChI | InChI=1S/C22H18Cl2N2O2S/c1-13-3-5-15(11-18(13)23)20-9-7-17(28-20)8-10-21(27)26-22(29)25-16-6-4-14(2)19(24)12-16/h3-12H,1-2H3,(H2,25,26,27,29)/b10-8+ |
| InChIKey | ICECPESEPUDQGS-CSKARUKUSA-N |
| XLogP | 6.40 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|