C28H21Cl2N3O3S — CID 21169601
3-chloro-N-[4-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]benzamide (PubChem CID 21169601) has the molecular formula C28H21Cl2N3O3S and a molecular weight of 550.47 g/mol. Its IUPAC name is 3-chloro-N-[4-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 21169601 |
| Molecular Formula | C28H21Cl2N3O3S |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 3-chloro-N-[4-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3ccc(NC(=O)c4cccc(Cl)c4)cc3)o2)cc1Cl |
| InChI | InChI=1S/C28H21Cl2N3O3S/c1-17-5-6-18(16-24(17)30)25-13-11-23(36-25)12-14-26(34)33-28(37)32-22-9-7-21(8-10-22)31-27(35)19-3-2-4-20(29)15-19/h2-16H,1H3,(H,31,35)(H2,32,33,34,37)/b14-12+ |
| InChIKey | MPERDWIHWOMZEF-WYMLVPIESA-N |
| XLogP | 7.34 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|