C21H15Cl3N2O2S — CID 23096087
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(3,5-dichlorophenyl)carbamothioyl]prop-2-enamide (PubChem CID 23096087) has the molecular formula C21H15Cl3N2O2S and a molecular weight of 465.79 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(3,5-dichlorophenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(3,5-dichlorophenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 23096087 |
| Molecular Formula | C21H15Cl3N2O2S |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 463.99 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(3,5-dichlorophenyl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3cc(Cl)cc(Cl)c3)o2)cc1Cl |
| InChI | InChI=1S/C21H15Cl3N2O2S/c1-12-2-3-13(8-18(12)24)19-6-4-17(28-19)5-7-20(27)26-21(29)25-16-10-14(22)9-15(23)11-16/h2-11H,1H3,(H2,25,26,27,29)/b7-5+ |
| InChIKey | YEBCTNDLQGRNAW-FNORWQNLSA-N |
| XLogP | 6.74 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|