C23H20ClIN2O2S — CID 21169617
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 21169617) has the molecular formula C23H20ClIN2O2S and a molecular weight of 550.85 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 21169617 |
| Molecular Formula | C23H20ClIN2O2S |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 550.00 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3cc(C)c(I)cc3C)o2)cc1Cl |
| InChI | InChI=1S/C23H20ClIN2O2S/c1-13-4-5-16(12-18(13)24)21-8-6-17(29-21)7-9-22(28)27-23(30)26-20-11-14(2)19(25)10-15(20)3/h4-12H,1-3H3,(H2,26,27,28,30)/b9-7+ |
| InChIKey | FHMYGHDIQQBJMH-VQHVLOKHSA-N |
| XLogP | 6.66 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|