C21H16Cl2N2O2S — CID 4008388
N-[(5-chloro-2-methylphenyl)carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 4008388) has the molecular formula C21H16Cl2N2O2S and a molecular weight of 431.34 g/mol. Its IUPAC name is N-[(5-chloro-2-methylphenyl)carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[(5-chloro-2-methylphenyl)carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4008388 |
| Molecular Formula | C21H16Cl2N2O2S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | N-[(5-chloro-2-methylphenyl)carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(Cl)cc1NC(=S)NC(=O)C=Cc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H16Cl2N2O2S/c1-13-2-5-16(23)12-18(13)24-21(28)25-20(26)11-9-17-8-10-19(27-17)14-3-6-15(22)7-4-14/h2-12H,1H3,(H2,24,25,26,28) |
| InChIKey | BDKKXWWPIKAZLS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|