C26H21ClN6O2S2 — CID 3325731
3-[5-(4-chlorophenyl)furan-2-yl]-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]prop-2-enamide (PubChem CID 3325731) has the molecular formula C26H21ClN6O2S2 and a molecular weight of 549.08 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3325731 |
| Molecular Formula | C26H21ClN6O2S2 |
| Molecular Weight | 549.08 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]prop-2-enamide |
| SMILES | CCc1nnc2sc(-c3ccc(C)c(NC(=S)NC(=O)C=Cc4ccc(-c5ccc(Cl)cc5)o4)c3)nn12 |
| InChI | InChI=1S/C26H21ClN6O2S2/c1-3-22-30-31-26-33(22)32-24(37-26)17-5-4-15(2)20(14-17)28-25(36)29-23(34)13-11-19-10-12-21(35-19)16-6-8-18(27)9-7-16/h4-14H,3H2,1-2H3,(H2,28,29,34,36) |
| InChIKey | DCEFZVVPQCBNKX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.08 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|