C24H19N7O4S2 — CID 2222549
N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 2222549) has the molecular formula C24H19N7O4S2 and a molecular weight of 533.60 g/mol. Its IUPAC name is N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2222549 |
| Molecular Formula | C24H19N7O4S2 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | CCc1nnc2sc(-c3ccc(C)c(NC(=S)NC(=O)c4ccc(-c5cccc([N+](=O)[O-])c5)o4)c3)nn12 |
| InChI | InChI=1S/C24H19N7O4S2/c1-3-20-27-28-24-30(20)29-22(37-24)15-8-7-13(2)17(12-15)25-23(36)26-21(32)19-10-9-18(35-19)14-5-4-6-16(11-14)31(33)34/h4-12H,3H2,1-2H3,(H2,25,26,32,36) |
| InChIKey | BFFHXLCOGIEJKP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|