C21H18Br2N6O2S2 — CID 3378043
3,5-dibromo-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 3378043) has the molecular formula C21H18Br2N6O2S2 and a molecular weight of 610.36 g/mol. Its IUPAC name is 3,5-dibromo-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3378043 |
| Molecular Formula | C21H18Br2N6O2S2 |
| Molecular Weight | 610.36 g/mol |
| Exact Mass | 607.93 |
| IUPAC Name | 3,5-dibromo-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCc1nnc2sc(-c3ccc(C)c(NC(=S)NC(=O)c4cc(Br)cc(Br)c4OC)c3)nn12 |
| InChI | InChI=1S/C21H18Br2N6O2S2/c1-4-16-26-27-21-29(16)28-19(33-21)11-6-5-10(2)15(7-11)24-20(32)25-18(30)13-8-12(22)9-14(23)17(13)31-3/h5-9H,4H2,1-3H3,(H2,24,25,30,32) |
| InChIKey | ROLZMGMYTOKTHO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|