C21H20N6O2S2 — CID 17103010
N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 17103010) has the molecular formula C21H20N6O2S2 and a molecular weight of 452.57 g/mol. Its IUPAC name is N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 17103010 |
| Molecular Formula | C21H20N6O2S2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | CCc1nnc2sc(-c3ccc(NC(=S)NC(=O)c4ccc(OC)cc4)c(C)c3)nn12 |
| InChI | InChI=1S/C21H20N6O2S2/c1-4-17-24-25-21-27(17)26-19(31-21)14-7-10-16(12(2)11-14)22-20(30)23-18(28)13-5-8-15(29-3)9-6-13/h5-11H,4H2,1-3H3,(H2,22,23,28,30) |
| InChIKey | FMABAEALKZWZIM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|