C21H21N5O2S — CID 17176814
N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]-3,4-dimethylbenzamide (PubChem CID 17176814) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]-3,4-dimethylbenzamide.
| Compound Name | N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 17176814 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]-3,4-dimethylbenzamide |
| SMILES | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)c4ccc(C)c(C)c4)c3)nn12 |
| InChI | InChI=1S/C21H21N5O2S/c1-5-18-23-24-21-26(18)25-20(29-21)15-8-9-17(28-4)16(11-15)22-19(27)14-7-6-12(2)13(3)10-14/h6-11H,5H2,1-4H3,(H,22,27) |
| InChIKey | GQAWIFBEBILJDB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |