C14H12F3N5O2S — CID 17176879
N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]-2,2,2-trifluoroacetamide (PubChem CID 17176879) has the molecular formula C14H12F3N5O2S and a molecular weight of 371.34 g/mol. Its IUPAC name is N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 17176879 |
| Molecular Formula | C14H12F3N5O2S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]-2,2,2-trifluoroacetamide |
| SMILES | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)C(F)(F)F)c3)nn12 |
| InChI | InChI=1S/C14H12F3N5O2S/c1-3-10-19-20-13-22(10)21-11(25-13)7-4-5-9(24-2)8(6-7)18-12(23)14(15,16)17/h4-6H,3H2,1-2H3,(H,18,23) |
| InChIKey | ZYFGJDGGWKQELY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |