C21H19Cl2N5O3S — CID 41316301
(2R)-2-(2,4-dichlorophenoxy)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]propanamide (PubChem CID 41316301) has the molecular formula C21H19Cl2N5O3S and a molecular weight of 492.39 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]propanamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]propanamide |
|---|---|
| PubChem CID | 41316301 |
| Molecular Formula | C21H19Cl2N5O3S |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]propanamide |
| SMILES | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)[C@@H](C)Oc4ccc(Cl)cc4Cl)c3)nn12 |
| InChI | InChI=1S/C21H19Cl2N5O3S/c1-4-18-25-26-21-28(18)27-20(32-21)12-5-7-17(30-3)15(9-12)24-19(29)11(2)31-16-8-6-13(22)10-14(16)23/h5-11H,4H2,1-3H3,(H,24,29)/t11-/m1/s1 |
| InChIKey | OEVXGMKIZQSJRA-LLVKDONJSA-N |
| XLogP | 5.14 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |