C11H8Cl2N4S — CID 11840527
6-(3,4-dichlorophenyl)-3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 11840527) has the molecular formula C11H8Cl2N4S and a molecular weight of 299.19 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(3,4-dichlorophenyl)-3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 11840527 |
| Molecular Formula | C11H8Cl2N4S |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CCc1nnc2sc(-c3ccc(Cl)c(Cl)c3)nn12 |
| InChI | InChI=1S/C11H8Cl2N4S/c1-2-9-14-15-11-17(9)16-10(18-11)6-3-4-7(12)8(13)5-6/h3-5H,2H2,1H3 |
| InChIKey | AIQPAGHNQMSRJW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |