C11H7Cl3N4S — CID 50849965
3-ethyl-6-(2,3,5-trichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 50849965) has the molecular formula C11H7Cl3N4S and a molecular weight of 333.63 g/mol. Its IUPAC name is 3-ethyl-6-(2,3,5-trichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-ethyl-6-(2,3,5-trichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 50849965 |
| Molecular Formula | C11H7Cl3N4S |
| Molecular Weight | 333.63 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 3-ethyl-6-(2,3,5-trichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CCc1nnc2sc(-c3cc(Cl)cc(Cl)c3Cl)nn12 |
| InChI | InChI=1S/C11H7Cl3N4S/c1-2-8-15-16-11-18(8)17-10(19-11)6-3-5(12)4-7(13)9(6)14/h3-4H,2H2,1H3 |
| InChIKey | WSATUVYQBKHOTO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|