C12H10N6S2 — CID 114354076
6-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-1,3-benzothiazol-2-amine (PubChem CID 114354076) has the molecular formula C12H10N6S2 and a molecular weight of 302.39 g/mol. Its IUPAC name is 6-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 114354076 |
| Molecular Formula | C12H10N6S2 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 6-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-1,3-benzothiazol-2-amine |
| SMILES | CCc1nnc2sc(-c3ccc4nc(N)sc4c3)nn12 |
| InChI | InChI=1S/C12H10N6S2/c1-2-9-15-16-12-18(9)17-10(20-12)6-3-4-7-8(5-6)19-11(13)14-7/h3-5H,2H2,1H3,(H2,13,14) |
| InChIKey | OMMGXKOYQXCSIP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |