C11H11N5S — CID 65348347
6-(2-ethyl-1,2,4-triazol-3-yl)-1,3-benzothiazol-2-amine (PubChem CID 65348347) has the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. Its IUPAC name is 6-(2-ethyl-1,2,4-triazol-3-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(2-ethyl-1,2,4-triazol-3-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 65348347 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 6-(2-ethyl-1,2,4-triazol-3-yl)-1,3-benzothiazol-2-amine |
| SMILES | CCn1ncnc1-c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C11H11N5S/c1-2-16-10(13-6-14-16)7-3-4-8-9(5-7)17-11(12)15-8/h3-6H,2H2,1H3,(H2,12,15) |
| InChIKey | ZDSSUYGNMOEXHJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |