C19H18N4O2S — CID 126700906
6-(6-ethoxy-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 126700906) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 6-(6-ethoxy-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(6-ethoxy-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 126700906 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 6-(6-ethoxy-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | CCOc1cc2c3c(c1)nc(-c1ccc4nc(N)sc4c1)n3CCCO2 |
| InChI | InChI=1S/C19H18N4O2S/c1-2-24-12-9-14-17-15(10-12)25-7-3-6-23(17)18(21-14)11-4-5-13-16(8-11)26-19(20)22-13/h4-5,8-10H,2-3,6-7H2,1H3,(H2,20,22) |
| InChIKey | PBTXXMUSDUNZLW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |