C22H22N4O4S — CID 126700041
tert-butyl N-[6-(6-hydroxy-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-1,3-benzothiazol-2-yl]carbamate (PubChem CID 126700041) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is tert-butyl N-[6-(6-hydroxy-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-1,3-benzothiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[6-(6-hydroxy-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-1,3-benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 126700041 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | tert-butyl N-[6-(6-hydroxy-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-1,3-benzothiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2ccc(-c3nc4cc(O)cc5c4n3CCCO5)cc2s1 |
| InChI | InChI=1S/C22H22N4O4S/c1-22(2,3)30-21(28)25-20-24-14-6-5-12(9-17(14)31-20)19-23-15-10-13(27)11-16-18(15)26(19)7-4-8-29-16/h5-6,9-11,27H,4,7-8H2,1-3H3,(H,24,25,28) |
| InChIKey | IYHXDECJNIYWNP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |