C21H22N4O2 — CID 155032603
3-[6-(cyclopropylmethylamino)-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]benzamide (PubChem CID 155032603) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[6-(cyclopropylmethylamino)-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]benzamide.
| Compound Name | 3-[6-(cyclopropylmethylamino)-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]benzamide |
|---|---|
| PubChem CID | 155032603 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[6-(cyclopropylmethylamino)-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2nc3cc(NCC4CC4)cc4c3n2CCCO4)c1 |
| InChI | InChI=1S/C21H22N4O2/c22-20(26)14-3-1-4-15(9-14)21-24-17-10-16(23-12-13-5-6-13)11-18-19(17)25(21)7-2-8-27-18/h1,3-4,9-11,13,23H,2,5-8,12H2,(H2,22,26) |
| InChIKey | DBZUTWXNHDGOOH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |