C22H22N4O3 — CID 145271889
6-[6-(cyclopropylmethylamino)-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 145271889) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 6-[6-(cyclopropylmethylamino)-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[6-(cyclopropylmethylamino)-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 145271889 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 6-[6-(cyclopropylmethylamino)-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3nc4cc(NCC5CC5)cc5c4n3CCCO5)cc2N1 |
| InChI | InChI=1S/C22H22N4O3/c27-20-12-29-18-5-4-14(8-16(18)24-20)22-25-17-9-15(23-11-13-2-3-13)10-19-21(17)26(22)6-1-7-28-19/h4-5,8-10,13,23H,1-3,6-7,11-12H2,(H,24,27) |
| InChIKey | RDZMCRQJWPSYQE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |